
CAS 2026-08-6: naphthalene-1,8-diyldimethanol
Formula:C12H12O2
InChI:InChI=1/C12H12O2/c13-7-10-5-1-3-9-4-2-6-11(8-14)12(9)10/h1-6,13-14H,7-8H2
SMILES:c1cc2cccc(CO)c2c(c1)CO
Synonyms:- 1,8-Bis(hydroxymethyl)naphthalene
- 1,8-Naphthalenedimethanol
- Naphthalene-1,8-diyldimethanol
Sort by
Found 3 products.
[8-(Hydroxymethyl)naphthalen-1-yl]methanol
CAS:This compound belongs to a group of naphthalenes that have the hydroxy group on the 1-position. It can be synthesized by refluxing 8-(hydroxymethyl)naphthalene-1-ol with sodium methoxide in ethanol. The crystal structure of this compound has been determined and it was found that the molecule exists in two conformations. These conformations are distinguished by steric interactions between the hydroxy group and the naphthalene ring, which is responsible for the difference in reactivity. The herringbone conformation is more stable than the chair conformation due to a stronger interaction between the hydroxyl group and an adjacent hydrogen atom on one of the naphthalene rings.Formula:C12H12O2Purity:Min. 95%Molecular weight:188.23 g/mol1,8-Naphthalenedimethanol
CAS:Formula:C12H12O2Purity:98%Color and Shape:SolidMolecular weight:188.2225