
CAS 202982-72-7: 4-Chloro-3-iodophenol
Formula:C6H4ClIO
InChI:InChI=1S/C6H4ClIO/c7-5-2-1-4(9)3-6(5)8/h1-3,9H
InChI key:InChIKey=UPIATGHEVZKVRT-UHFFFAOYSA-N
SMILES:IC1=C(Cl)C=CC(O)=C1
Synonyms:- Phenol, 4-Chloro-3-Iodo-
- 4-Chloro-3-iodophenol
Sort by
Found 4 products.
4-Chloro-3-iodophenol
CAS:Purity:95.0%Color and Shape:Liquid, No data available.Molecular weight:254.44999694824224-Chloro-3-iodophenol
CAS:4-Chloro-3-iodophenolFormula:C6H4ClIOPurity:By gc: 98.6% (Typical Value in Batch COA)Color and Shape: white solidMolecular weight:254.45g/molPhenol, 4-chloro-3-iodo-
CAS:Formula:C6H4ClIOPurity:98%Color and Shape:SolidMolecular weight:254.45284-Chloro-3-iodophenol
CAS:4-Chloro-3-iodophenol is a reactive chemical substance that can be used as a reagent in the synthesis of diagnostic agents, sunscreens and disinfectants. The reaction rate is increased by the presence of chlorine and other halogens such as iodine or bromine. 4-Chloro-3-iodophenol reacts with triclosan to form chlorinated trihalomethanes, which are more efficient disinfectants than their nonchlorinated counterparts. However, 4-chloro-3-iodophenol can also react with the oxidant hydrogen peroxide to form an unstable intermediate compound that degrades into toxic products like hypochlorous acid and chloramines. This instability makes this substance unsuitable for use in certain applications such as water purification.Formula:C6H4ClIOPurity:Min. 98 Area-%Color and Shape:PowderMolecular weight:254.45 g/mol