CAS 2034-69-7: Daphnoretin
Formula:C19H12O7
InChI:InChI=1S/C19H12O7/c1-23-16-6-11-7-17(19(22)26-15(11)9-13(16)20)24-12-4-2-10-3-5-18(21)25-14(10)8-12/h2-9,20H,1H3
InChI key:InChIKey=JRHMMVBOTXEHGJ-UHFFFAOYSA-N
SMILES:O(C1=CC=2C(OC1=O)=CC(O)=C(OC)C2)C=3C=C4C(=CC3)C=CC(=O)O4
Synonyms:- 2H-1-benzopyran-2-one, 7-hydroxy-6-methoxy-3-[(2-oxo-2H-1-benzopyran-7-yl)oxy]-
- 7-Hydroxy-6-methoxy-3-[(2-oxo-2H-1-benzopyran-7-yl)oxy]-2H-1-benzopyran-2-one
- Coumarin, 7-hydroxy-6-methoxy-3,7′-oxydi-
- Daphnoretin
- NSC 291852
- Thymelol
Sort by
Found 7 products.
Daphnoretin
CAS:Daphnoretin is a naturally occurring lignan, which is a type of product derived from plant sources, particularly species of the genus Daphne. It is characterized by its complex chemical structure and is known for its potential bioactive properties. The mode of action of daphnoretin involves modulating various cellular pathways, including those related to apoptosis and oxidative stress, through its interaction with cellular receptors and enzymes. This modulation can lead to either the inhibition or activation of specific cellular processes, which is of significant interest in scientific research. The uses and applications of daphnoretin are primarily in the realm of biomedical research. Scientists are exploring its potential therapeutic effects, particularly its anti-cancer and anti-inflammatory properties. Research has indicated that daphnoretin may exhibit cytotoxic effects against certain cancer cell lines, making it a subject of interest in the development of novel chemotherapeutic agents. Additionally, its ability to influence oxidative stress pathways suggests potential applications in conditions associated with chronic inflammation. Despite these promising avenues, further research is required to fully elucidate the mechanisms and therapeutic potential of daphnoretin.Formula:C19H12O7Purity:Min. 95%Color and Shape:PowderMolecular weight:352.29 g/mol2H-1-Benzopyran-2-one, 7-hydroxy-6-methoxy-3-[(2-oxo-2H-1-benzopyran-7-yl)oxy]-
CAS:Formula:C19H12O7Purity:98%Molecular weight:352.2944Daphnoretin
CAS:LactoneFormula:C19H12O7Purity:≥ 98.0 % (HPLC)Color and Shape:PowderMolecular weight:352.3
![2H-1-Benzopyran-2-one, 7-hydroxy-6-methoxy-3-[(2-oxo-2H-1-benzopyran-7-yl)oxy]-](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fproducts%2FIN%2Fthumb%2FDA0028VG.jpg&w=3840&q=75)
