
CAS 20357-21-5: 2-Bromo-6-nitrobenzaldehyde
Formula:C7H4BrNO3
InChI:InChI=1S/C7H4BrNO3/c8-6-2-1-3-7(9(11)12)5(6)4-10/h1-4H
InChI key:InChIKey=WRIAMYXQKSDDRP-UHFFFAOYSA-N
SMILES:C(=O)C1=C(N(=O)=O)C=CC=C1Br
Synonyms:- Benzaldehyde, 2-Bromo-6-Nitro-
- Wnr Ce Bvh
- 2-Bromo-6-nitrobenzaldehyde
Sort by
Found 4 products.
2-Bromo-6-nitrobenzaldehyde
CAS:2-Bromo-6-nitrobenzaldehyde is a chemical compound that can be synthesized by the reaction of hydrogen chloride and 2-bromoacetophenone. Mechanistically, this reaction proceeds through chlorination of the indole ring, which causes protonation and ring closure. The resulting product undergoes hydrochloric acid catalysis to form a dithioacetal, which is then chlorinated with chloroform to produce the final product. The bromine atom in 2-bromo-6-nitrobenzaldehyde is substituted with chlorine to create 2-chloro-6-nitrobenzaldehyde. This substitution changes the reactivity of the molecule, as well as its physical properties.Formula:C7H4BrNO3Purity:Min. 95%Color and Shape:Beige SolidMolecular weight:230.02 g/molRef: 3D-FB05063
Discontinued productBenzaldehyde, 2-bromo-6-nitro-
CAS:Formula:C7H4BrNO3Purity:98%Color and Shape:SolidMolecular weight:230.01562-Bromo-6-nitrobenzaldehyde
CAS:2-Bromo-6-nitrobenzaldehydeFormula:C7H4BrNO3Purity:98%Color and Shape: yellow solidMolecular weight:230.02g/mol