
CAS 20377-01-9: 5-azidoquinoline
Formula:C9H6N4
InChI:InChI=1/C9H6N4/c10-13-12-9-5-1-4-8-7(9)3-2-6-11-8/h1-6H
SMILES:c1cc2c(cccn2)c(c1)N=[N+]=[NH-]
Synonyms:- Quinoline, 5-azido-
Sort by
Found 2 products.
5-Azidoquinoline
CAS:5-Azidoquinoline is a molecule with the molecular formula CHN. It is classified as an oxadiazoloquinine and has a range of chemical properties that make it suitable for use in medicine, including its ability to form halides and nitro groups. 5-Azidoquinoline can also be used to synthesize other molecules, such as chloroacetone, by nucleophilic substitution reactions. The electronegativity of the 5-azido group makes it an excellent nucleophile, which allows for kinetic reactions. This molecule has six different heterocycles and can be substituted with halogens or other azides.Formula:C9H6N4Purity:Min. 95%Molecular weight:170.17 g/mol