
CAS 2040-14-4: 1-(2-methylphenyl)propan-1-one
Formula:C10H12O
InChI:InChI=1/C10H12O/c1-3-10(11)9-7-5-4-6-8(9)2/h4-7H,3H2,1-2H3
SMILES:CCC(=O)c1ccccc1C
Synonyms:- 1-Propanone, 1-(2-Methylphenyl)-
- 2-Methylpropiophenone
- Propiophenone, 2'-methyl-
Sort by
Found 5 products.
2'-Methylpropiophenone
CAS:2'-Methylpropiophenone is a photochemical reaction product of hexane and methanol. It has been shown to undergo a photochemical cyclization reaction with the production of a six-membered ring. This process is catalyzed by light and the substituent groups on the molecule determine which type of cyclization occurs. 2'-Methylpropiophenone can also be produced by a chain photochemical reaction, which involves the oxidation of an alkene in the presence of oxygen.Formula:C10H12OPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:148.2 g/molRef: 3D-FM67454
Discontinued product1-Propanone, 1-(2-methylphenyl)-
CAS:Formula:C10H12OPurity:95%Color and Shape:LiquidMolecular weight:148.20172'-Methylpropiophenone
CAS:2'-MethylpropiophenoneFormula:C10H12OPurity:98%Color and Shape: light yellow liquidMolecular weight:148.20g/mol