
CAS 20422-13-3: 1-benzylazepane
Formula:C13H19N
InChI:InChI=1/C13H19N/c1-2-7-11-14(10-6-1)12-13-8-4-3-5-9-13/h3-5,8-9H,1-2,6-7,10-12H2
Synonyms:- 1H-Azepine, hexahydro-1-(phenylmethyl)-
Sort by
Found 4 products.
1-Benzylazepane
CAS:Benzylazepane is a triacetoxyborohydride that can be used for the reductive amination of aldehydes to form amines. Benzylazepane has been shown to react with sodium triacetoxyborohydride and amines to produce acrylonitrile, which is useful in the synthesis of polymers. The reductive amination of benzaldehyde with ethyl cyanoacetate forms acrylonitrile and acetaldehyde, which is then oxidized using ozonolysis. This reaction produces nitroethane, nitromethane, and acrylamide. Benzylazepane is also used in the synthesis of nature-inspired molecules such as polysaccharides and nucleotides.Formula:C13H19NPurity:Min. 95%Molecular weight:189.3 g/mol