Bis(4-chloro-2-nitrophenyl) disulfide, with the CAS number 2050-66-0, is an organic compound characterized by its disulfide linkage and the presence of two 4-chloro-2-nitrophenyl groups. This compound typically appears as a solid and is known for its yellow to orange color, which is indicative of the nitro groups present. It is relatively stable under standard conditions but can undergo reactions typical of disulfides, such as oxidation and reduction. The presence of chlorine and nitro substituents contributes to its reactivity and potential applications in organic synthesis, particularly in the development of dyes and pharmaceuticals. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Safety precautions should be taken when handling this substance, as it may pose health risks due to its chemical properties. Overall, Bis(4-chloro-2-nitrophenyl) disulfide is a notable compound in the field of organic chemistry with various potential applications.

Bis(4-chloro-2-nitrophenyl) disulfide

2050-66-0: 1,1'-Disulfanediylbis(4-Chloro-2-Nitrobenzene), Ai3-08871, Bis(2-nitro-4-chlorophenyl) disulfide, Bis(4-chloro-2-nitrophenyl) disulfide, Disulfide, bis(4-chloro-2-nitrophenyl), Nsc 6334

4-Chloro-1-[(4-chloro-2-nitrophenyl)dithio]-2-nitrobenzene

Bis(4-chloro-2-nitrophenyl) Disulfide

Di(4-chloro-2-nitrophenyl) disulphide

2,2'-Dinitro-4,4'-dichloro diphenyl disUfide (DNPD) is a substance with the molecular formula C6H3Cl2N2O2S. It is produced by the reaction of sodium sulfide and phosgene. DNPD has been used as an intermediate in organic synthesis and as a reagent for organic reactions. In addition, DNPD has been used to produce polyurethane foam, which is commonly used in furniture cushions.

CAS 2050-66-0: Bis(4-chloro-2-nitrophenyl) disulfide

4-Chloro-1-[(4-chloro-2-nitrophenyl)dithio]-2-nitrobenzene

Ref: 10-F068154

Bis(4-chloro-2-nitrophenyl) Disulfide

Ref: 3B-B4247

Di(4-chloro-2-nitrophenyl) disulphide

Ref: 54-OR22303

2,2'-Dinitro-4,4'-dichloro diphenyl disUfide

Ref: 3D-FD41607

Disulfide, bis(4-chloro-2-nitrophenyl)

Ref: IN-DA0029SV