CAS 20595-44-2: 2,3-Dichlorocinnamic acid
Formula:C9H6Cl2O2
InChI:InChI=1/C9H6Cl2O2/c10-7-3-1-2-6(9(7)11)4-5-8(12)13/h1-5H,(H,12,13)/b5-4+
Synonyms:- (2E)-3-(2,3-dichlorophenyl)prop-2-enoate
- (2E)-3-(2,3-dichlorophenyl)prop-2-enoic acid
Sort by
Found 3 products.
2-Propenoic acid, 3-(2,3-dichlorophenyl)-, (2E)-
CAS:Formula:C9H6Cl2O2Purity:97%Color and Shape:SolidMolecular weight:217.04872,3-Dichlorocinnamic acid
CAS:2,3-Dichlorocinnamic acid is an organic compound that can be synthesized in a multistep process involving the reaction of pyridine with sulfuryl chloride. This reaction forms 2,3-dichloropropiophenone and 2,3-dichloroacetophenone. The latter compound is converted to the desired product by reacting it with thionyl chloride. The final step involves hydrolysis of the ester group to form 2,3-dichlorocinnamic acid. 2,3-Dichlorocinnamic acid can also be synthesized from phenylpropiolic acid and chlorosulfuric acid or from methyl propiolate and chlorosulfuric acid. 2,3-Dichlorocinnamic acid is a white crystalline solid that melts at 155°C and boils at 287°C. It is soluble in water and has a low yield due toFormula:C9H6Cl2O2Purity:Min. 95%Molecular weight:217.05 g/mol
