CAS 20869-95-8: Ermanin
Formula:C17H14O6
InChI:InChI=1S/C17H14O6/c1-21-11-5-3-9(4-6-11)16-17(22-2)15(20)14-12(19)7-10(18)8-13(14)23-16/h3-8,18-19H,1-2H3
InChI key:InChIKey=RJCJVIFSIXKSAH-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC=2C(C1=O)=C(O)C=C(O)C2)C3=CC=C(OC)C=C3
Synonyms:- 3,4′-Di-O-methylkaempferol
- 4H-1-Benzopyran-4-one, 5,7-dihydroxy-3-methoxy-2-(4-methoxyphenyl)-
- 5,7-Dihydroxy-3,4′-dimethoxyflavone
- 5,7-Dihydroxy-3-methoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one
- 5,7-dihydroxy-3-methoxy-2-(4-methoxyphenyl)-4H-chromen-4-one
- Dimethyl-3,4′-kaempferol
- Ermanin
- Flavone, 5,7-dihydroxy-3,4′-dimethoxy-
- Kaempferol 3,4′-di-O-methyl ether
- Kaempferol 3,4′-dimethyl ether
- Nsc 31882
- See more synonyms
Sort by
Found 8 products.
Kaempferol-3,4'-dimethyl ether
CAS:Kaempferol-3,4'-dimethyl ether is a naturally occurring flavonoid compound which is primarily found in various plants. This compound is known for its structural classification as a methylated flavonol, distinguished by the presence of ether groups at the 3 and 4' positions of kaempferol. Derived mainly from botanical sources such as herbs and traditional medicinal plants, it plays a critical role in plant defense mechanisms. Kaempferol-3,4'-dimethyl ether exerts its biological effects through its antioxidant capabilities, scavenging free radicals and potentially modulating various signaling pathways involved in cellular processes. Its mode of action is primarily through the inhibition of oxidative stress, which contributes to its potential protective effects on cellular integrity. The scientific community has shown considerable interest in kaempferol-3,4'-dimethyl ether due to its diverse applications in research focused on cancer, cardiovascular diseases, and neurodegenerative disorders. Additionally, it serves as a valuable tool in elucidating flavonoid-related pathways and mechanisms, offering potential insights into therapeutic approaches for oxidative stress-related conditions.Formula:C17H14O6Purity:Min. 95%Color and Shape:PowderMolecular weight:314.29 g/mol4H-1-Benzopyran-4-one, 5,7-dihydroxy-3-methoxy-2-(4-methoxyphenyl)-
CAS:Formula:C17H14O6Purity:98%Molecular weight:314.2895Ermanin
CAS:Ermanin is a flavonoid isolated from Tanacetum microphyllum.Ermanin inhibits platelet aggregation and has anti-tuberculosis and anti-viral/bacterial properties.Formula:C17H14O6Purity:98.46%Color and Shape:SolidMolecular weight:314.29
