
CAS 20876-29-3: 5-Methoxy-2-nitrobenzeneacetic acid
Formula:C9H9NO5
InChI:InChI=1S/C9H9NO5/c1-15-7-2-3-8(10(13)14)6(4-7)5-9(11)12/h2-4H,5H2,1H3,(H,11,12)
InChI key:InChIKey=QBRHCFNZQWZEQM-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=C(N(=O)=O)C=CC(OC)=C1
Synonyms:- (5-Methoxy-2-nitrophenyl)acetic acid
- 2-(5-Methoxy-2-nitrophenyl)acetic acid
- 5-Methoxy-2-nitrobenzeneacetic acid
- Acetic acid, (5-methoxy-2-nitrophenyl)-
- Aceticacid, (5-methoxy-2-nitrophenyl)- (8CI)
- Benzeneacetic acid, 5-methoxy-2-nitro-
Sort by
Found 4 products.
(5-Methoxy-2-Nitro-Phenyl)-Acetic Acid
CAS:5-Methoxy-2-nitrobenzoic acid is a hydroxy derivative of 5-methoxyindole-2-acetic acid. It is used in the synthesis of various drugs and pesticides, such as chloroquine, pentamidine and carbonyl chloride. 5-Methoxy-2-nitrobenzoic acid is also used in the synthesis of esters, methylene compounds and indole derivatives. This chemical has shown to have anticancer properties and may be used as a potential therapeutic agent for cancer treatment.Formula:C9H9NO5Purity:Min. 95%Molecular weight:211.17 g/mol2-(5-Methoxy-2-nitrophenyl)acetic acid
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:211.173004150390622-(5-Methoxy-2-nitrophenyl)acetic acid
CAS:2-(5-Methoxy-2-nitrophenyl)acetic acidPurity:95%Molecular weight:211.17g/molBenzeneacetic acid, 5-methoxy-2-nitro-
CAS:Formula:C9H9NO5Purity:97%Color and Shape:SolidMolecular weight:211.1715