
CAS 210108-90-0: 3aH-Cyclopentacyclododecene-1,2,3a,4,9,10,11,13-octol, 1,2,3,4,5,8,9,10,11,12,13,13a-dodecahydro-2,5,8,8-tetramethyl-12-methylene-, 2,4,9,11,13-pentaacetate 1-benzoate, (1R,2R,3aR,4S,5S,6E,9S,10S,11S,13R,13aS)-
Formula:C37H48O14
InChI:InChI=1S/C37H48O14/c1-19-16-17-35(8,9)33(49-24(6)41)28(43)30(47-22(4)39)20(2)29(46-21(3)38)27-32(50-34(44)26-14-12-11-13-15-26)36(10,51-25(7)42)18-37(27,45)31(19)48-23(5)40/h11-17,19,27-33,43,45H,2,18H2,1,3-10H3/b17-16+/t19-,27-,28+,29-,30-,31-,32+,33+,36+,37+/m0/s1
InChI key:InChIKey=FPNGPBYYMDKBKJ-OHGSERNNSA-N
SMILES:O(C(=O)C1=CC=CC=C1)[C@@H]2[C@]3([C@@](O)([C@@H](OC(C)=O)[C@@H](C)/C=C/C(C)(C)[C@H](OC(C)=O)[C@H](O)[C@@H](OC(C)=O)C(=C)[C@@H]3OC(C)=O)C[C@]2(OC(C)=O)C)[H]
Synonyms:- 3aH-Cyclopentacyclododecene-1,2,3a,4,9,10,11,13-octol, 1,2,3,4,5,8,9,10,11,12,13,13a-dodecahydro-2,5,8,8-tetramethyl-12-methylene-, 2,4,9,11,13-pentaacetate 1-benzoate, (1R,2R,3aR,4S,5S,6E,9S,10S,11S,13R,13aS)-
- Jatrophane 6
Sort by
Found 3 products.
Jatrophane VI
CAS:Jatrophane VI is a natural product for research related to life sciences. The catalog number is TN4354 and the CAS number is 210108-90-0.Formula:C37H48O14Purity:98%Color and Shape:SolidMolecular weight:716.77Jatrophane 6
CAS:Jatrophane 6 is a diterpenoid ester, which is a bioactive compound sourced from the Euphorbia species, a genus of flowering plants widely found in varied climates. This compound is known to exhibit significant biological activities, primarily due to its complex molecular structure that allows it to interact with various cellular pathways. The mode of action of Jatrophane 6 involves modulating multidrug resistance proteins, which are vital in developing resistance within cancer cells during chemotherapy. By inhibiting these proteins, it enhances the efficacy of anti-cancer drugs, making it a promising candidate for overcoming drug resistance. The uses and applications of Jatrophane 6 are primarily in the field of cancer research, where its ability to reverse multidrug resistance presents a valuable tool for researchers developing new therapeutic strategies. Additionally, its unique structure and activity profile make it an interesting compound for studying the intricate mechanisms of cellular resistance and drug interaction. Scientists continue to explore its full range of applications beyond oncology, given its potential impact on other diseases influenced by similar resistance mechanisms.Formula:C37H48O14Purity:Min. 95%Molecular weight:716.8 g/mol