
CAS 21021-53-4: 4-Nitrophenylsuccinic acid
Formula:C10H7NO6
InChI:InChI=1/C10H9NO6/c12-9(13)5-8(10(14)15)6-1-3-7(4-2-6)11(16)17/h1-4,8H,5H2,(H,12,13)(H,14,15)/p-2/t8-/m0/s1
SMILES:c1cc(ccc1[C@H](CC(=O)[O-])C(=O)[O-])N(=O)=O
Synonyms:- 2-(4-Nitrophenyl)Butanedioic Acid
- (2R)-2-(4-nitrophenyl)butanedioate
- (2S)-2-(4-nitrophenyl)butanedioate
Sort by
Found 4 products.
4-Nitrophenylsuccinic acid
CAS:4-Nitrophenylsuccinic acid is a hydrocarbon that is a precursor in the formation of phenyl succinic acid during the Friedel-Crafts reaction. The phenyl group is introduced by condensations with aromatic compounds, such as benzene, to form an aromatic hydrocarbon. 4-Nitrophenylsuccinic acid is also used to produce phenylalanine and vitamin B6.Formula:C10H9NO6Purity:Min. 95%Molecular weight:239.18 g/mol2-(4-Nitrophenyl)succinic Acid
CAS:Controlled ProductFormula:C10H9NO6Color and Shape:NeatMolecular weight:239.182Butanedioic acid, 2-(4-nitrophenyl)-
CAS:Formula:C10H9NO6Color and Shape:SolidMolecular weight:239.1816