
CAS 2130-17-8: Tetrahymanol
Formula:C30H52O
InChI:InChI=1S/C30H52O/c1-25(2)15-9-16-27(5)20(25)12-18-29(7)22(27)10-11-23-28(6)17-14-24(31)26(3,4)21(28)13-19-30(23,29)8/h20-24,31H,9-19H2,1-8H3/t20-,21-,22+,23+,24-,27-,28-,29+,30+/m0/s1
InChI key:InChIKey=BFNSRKHIVITRJP-VJBYBJRLSA-N
SMILES:C[C@]12[C@@]([C@]3(C)[C@@](CC1)(C(C)(C)[C@@H](O)CC3)[H])(CC[C@]4([C@@]2(C)CC[C@@]5([C@]4(C)CCCC5(C)C)[H])[H])[H]
Synonyms:- (21alpha)-Gammaceran-21-ol
- (3S,4aR,6aR,6bR,8aS,12aS,12bR,14aR,14bR)-4,4,6a,6b,9,9,12a,14b-Octamethyldocosahydro-3-picenol
- (3β)-Gammaceran-3-ol
- Gammaceran-21-Ol, (21Alpha)-
- Gammaceran-3-Ol, (3Beta)-
- Gammaceran-3-ol, (3β)-
- Gammaceran-3β-ol
- Tetrahymanol
- Wallichiniol
- (3beta)-Gammaceran-3-ol
Sort by
Found 3 products.
Tetrahymanol
CAS:Tetrahymanol is a pentacyclic triterpenoid hydrocarbon, which is isolated from various eukaryotic microorganisms, including certain protozoa and bacteria. These organisms naturally biosynthesize tetrahymanol as part of their membranes, where it plays a crucial role in modulating membrane fluidity and integrity. The mode of action of tetrahymanol involves its incorporation into the cell membrane, where it interacts with lipid bilayers, affecting their organization and dynamics. This interaction is essential for maintaining cell membrane stability under varying environmental conditions. In terms of applications, tetrahymanol serves as a biomarker for paleoclimatic and paleoenvironmental studies due to its presence in geological records. Its stability and unique structure make it suitable for reconstructing historical ecosystems and environmental conditions. Additionally, its role in membrane biology makes it a subject of interest in the study of membrane structure and function. Researchers explore its potential in understanding fundamental aspects of membrane dynamics and its possible implications in biotechnology and synthetic biology. Tetrahymanol's distinct chemical properties also render it a valuable compound for advanced biochemical research pursuits.Formula:C30H52OPurity:Min. 95%Molecular weight:428.70 g/molTetrahymanol
CAS:Tetrahymanol is a cyclic triterpenoid present in Tetrahymena pyriformis and marine sediments that does not require molecular oxygen.Formula:C30H52OPurity:98%Color and Shape:SolidMolecular weight:428.73