
CAS 213598-07-3: 3-Chloro-4-(1-methylethoxy)benzoic acid
Formula:C10H11ClO3
InChI:InChI=1S/C10H11ClO3/c1-6(2)14-9-4-3-7(10(12)13)5-8(9)11/h3-6H,1-2H3,(H,12,13)
InChI key:InChIKey=QXSPLPLQLJAPSM-UHFFFAOYSA-N
SMILES:O(C(C)C)C1=C(Cl)C=C(C(O)=O)C=C1
Synonyms:- 3-Chloro-4-(1-methylethoxy)benzoic acid
- 3-Chloro-4-(Propan-2-Yloxy)Benzoic Acid
- 3-Chloro-4-[(1-methylethyl)oxy]benzoic acid
- 3-Chloro-4-propan-2-yloxybenzoic acid
- Benzoic Acid, 3-Chloro-4-(1-Methylethoxy)-
- 3-Chloro-4-isopropoxybenzoic acid
Sort by
Found 5 products.
3-Chloro-4-isopropoxybenzoic acid
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:214.649993896484383-Chloro-4-isopropoxybenzoic acid
CAS:3-Chloro-4-isopropoxybenzoic acidPurity:95%Molecular weight:214.65g/mol3-Chloro-4-isopropoxybenzoicacid
CAS:3-Chloro-4-isopropoxybenzoicacid is a chemotherapeutic that inhibits the mitotic activity of cells. It has been shown to inhibit the proliferation of human cancer cells in high-throughput screening and clinical trials. 3-Chloro-4-isopropoxybenzoicacid is a potent inhibitor of kinesin, a protein involved in mitosis. Kinesins are motor proteins that transport cargo along microtubules during cell division. 3-Chloro-4-isopropoxybenzoicacid also inhibits the activity of other proteins involved in cellular proliferation, such as cyclin A and cyclin B1, which regulate the progression through the cell cycle.Formula:C10H11ClO3Purity:Min. 95%Molecular weight:214.65 g/molRef: 3D-FC150050
Discontinued productBenzoic acid, 3-chloro-4-(1-methylethoxy)-
CAS:Formula:C10H11ClO3Purity:97%Color and Shape:SolidMolecular weight:214.6455