CAS 2150-48-3: Pyronine B
Formula:C21H27N2O·Cl
InChI:InChI=1S/C21H27N2O.ClH/c1-5-22(6-2)18-11-9-16-13-17-10-12-19(23(7-3)8-4)15-21(17)24-20(16)14-18;/h9-15H,5-8H2,1-4H3;1H/q+1;/p-1
InChI key:InChIKey=CXZRDVVUVDYSCQ-UHFFFAOYSA-M
SMILES:N(CC)(CC)C1=CC2=C(C=C3C(=[O+]2)C=C(N(CC)CC)C=C3)C=C1.[Cl-]
Synonyms:- Ammonium, [6-(diethylamino)-3H-xanthen-3-ylidene]diethyl-, chloride
- Ethanaminium, N-[6-(diethylamino)-3H-xanthen-3-ylidene]-N-ethyl-, chloride
- N-[6-(diethylamino)-3H-xanthen-3-ylidene]-N-ethylethanaminium chloride
- N-[6-(diethylamino)-3H-xanthen-3-ylidene]-N-ethylethanaminium chloride trichloroiron (1:1)
- Pyronin B
- Pyronine B
- Pyronine B(By)
- Xanthylium, 3,6-bis(diethylamino)-, chloride
- Xanthylium, 3,6-bis(diethylamino)-, chloride (1:1)
- [6-(Diethylamino)-3H-xanthen-3-ylidene]diethylammonium chloride
- C.I. 45010
Sort by
Found 6 products.
Xanthylium, 3,6-bis(diethylamino)-, chloride
CAS:Formula:C21H27ClN2OPurity:%Color and Shape:SolidMolecular weight:358.9049Pyronin B
CAS:Pyronin B Certified is a fluorescent dye that is used in biological and environmental applications. It has been shown to have photophysical and surfactant properties, with a disulfide bond that can be cleaved by reducing agents. Pyronin B certified has been used in the analysis of biological samples, such as human serum and wastewater, due to its ability to bind proteins. This dye can also be used as a fluorescence probe for electrochemical impedance spectroscopy, which is an analytical technique used for determining the concentration of ions in solution.Formula:C42H54Cl8Fe2N4OPurity:60%Min (Dye Content)Molecular weight:1,026.22 g/molPyronine B
CAS:Pyronine B is a reagent of biochemical.Formula:C21H27ClN2OPurity:98%Color and Shape:SolidMolecular weight:358.91Pyronin B ferric chloride complex
CAS:Formula:C42H54Cl8Fe2N4O2Color and Shape:Green or red crystalsMolecular weight:1042.22
