CAS 21567-18-0: 4-(4-Chlorophenoxy)phenol
Formula:C12H9ClO2
InChI:InChI=1/C12H9ClO2/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1-8,14H
SMILES:c1cc(ccc1Cl)Oc1ccc(cc1)O
Synonyms:- 4-Hydroxy-4'-chloro-diphenylether
Sort by
Found 5 products.
4-Chloro-4'-hydroxydiphenyl Ether
CAS:Formula:C12H9ClO2Purity:>95.0%(GC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:220.654-Hydroxy-4'-chloro-diphenylether
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:220.649993896484384-(4-Chlorophenoxy)phenol
CAS:Formula:C12H9ClO2Purity:98%Color and Shape:SolidMolecular weight:220.65174-(4-Chlorophenoxy)phenol
CAS:4-(4-Chlorophenoxy)phenol (4CPP) is a sulphone that has the ability to undergo photolysis. It can be used in a photochemical reaction with hydroquinone to produce 4-chloro-2,2-diphenylacetophenone (2,2'-bithiophene). The 2,2'-bithiophene can then be oxidized by light or alkali metal salts and undergo nucleophilic addition. The final product of this pathway is 2-methylthioanisole. 4CPP binds to the nucleophile at an oxygen atom and displaces an alkali metal ion from the adjacent carbon atom. This process is called a displacement reaction. 4CPP also has the ability to undergo photolysis when exposed to UV light or a light source. This process produces free radicals that are short lived and react with oxygen in air to form peroxy radicals such as hydroxyl radicals and hydrogen perFormula:C12H9ClO2Purity:Min. 95%Molecular weight:220.65 g/molRef: 3D-FC54191
Discontinued product
