
CAS 2157-39-3: 5-chloroisophthalic acid
Formula:C8H5ClO4
InChI:InChI=1S/C8H5ClO4/c9-6-2-4(7(10)11)1-5(3-6)8(12)13/h1-3H,(H,10,11)(H,12,13)
InChI key:InChIKey=PLPFTLXIQQYOMW-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(C(O)=O)=CC(Cl)=C1
Synonyms:- 1,3-Benzenedicarboxylic acid, 5-chloro-
- 3-Carboxy-5-chlorobenzoic acid
- 5-Chloro-1,3-benzenedicarboxylic acid
- 5-Chlorobenzene-1,3-Dicarboxylic Acid
- Isophthalic acid, 5-chloro-
- 5-Chloroisophthalic acid
- 5-Chloroisophthalic acid
Sort by
Found 4 products.
5-chloroisophthalic acid
CAS:Formula:C8H5ClO4Purity:96%Color and Shape:SolidMolecular weight:200.57595-Chloroisophthalic acid
CAS:5-Chloroisophthalic acid is a condensation product of isophthalic acid and chlorine. It has been used as a feed additive to prevent animals from developing tuberculosis. The drug can also be used in the treatment of mycobacterium infections, such as tuberculosis or Mycobacterium avium complex. 5-Chloroisophthalic acid reacts with metal ions, such as aluminium, magnesium, and arachis, to form insoluble salts. This reaction prevents the growth of bacteria by inhibiting the synthesis of proteins needed for cell division and replication.Formula:C8H5ClO4Purity:Min. 95%Molecular weight:200.57 g/mol