
CAS 21667-60-7: 3-Methoxybenzoylacetonitrile
Formula:C10H9NO2
InChI:InChI=1/C10H9NO2/c1-13-9-4-2-3-8(7-9)10(12)5-6-11/h2-4,7H,5H2,1H3
SMILES:COc1cccc(c1)C(=O)CC#N
Synonyms:- 3-(3-Methoxyphenyl)-3-oxopropanenitrile
Sort by
Found 4 products.
3-(3-Methoxyphenyl)-3-oxo-propionitrile
CAS:3-(3-Methoxyphenyl)-3-oxo-propionitrile is a chemical compound that is used in the treatment of infectious diseases. It has been shown to inhibit the enzymatic activity of certain enzymes, such as carbonic anhydrase, which may be associated with autoimmune diseases. 3-(3-Methoxyphenyl)-3-oxo-propionitrile can also inhibit polymerase chain reactions by reversibly covalently binding to DNA and RNA. The reaction mechanism is not fully understood. 3-(3-Methoxyphenyl)-3-oxo-propionitrile binds to copper ions and forms a complex that inhibits the enzyme's catalytic activity. This type of inhibition is reversible because the copper ions are released when the nitrile group leaves the enzyme.Formula:C10H9NO2Purity:Min. 95%Molecular weight:175.18 g/mol3-Methoxybenzoylacetonitrile
CAS:3-MethoxybenzoylacetonitrilePurity:98%Color and Shape:PowderMolecular weight:175.18g/mol3-(3-Methoxyphenyl)-3-oxopropanenitrile
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:175.186996459960943-(3-Methoxyphenyl)-3-oxopropanenitrile
CAS:Formula:C10H9NO2Purity:98%Color and Shape:SolidMolecular weight:175.184