
CAS 216959-91-0: 4-(Pyrimidin-5-yl)benzoic acid
Formula:C11H7N2O2
InChI:InChI=1/C11H8N2O2/c14-11(15)9-3-1-8(2-4-9)10-5-12-7-13-6-10/h1-7H,(H,14,15)/p-1
SMILES:c1cc(ccc1c1cncnc1)C(=O)[O-]
Synonyms:- Benzoic acid, 4-(5-pyrimidinyl)-
- 4-Pyrimidin-5-Ylbenzoate
Sort by
Found 4 products.
4-Pyrimidin-5-yl-benzoicacid
CAS:4-Pyrimidin-5-yl-benzoic acid (4PB) is a heterofunctional molecule that has carboxylate and amide functional groups. The carboxylate group is used for the synthesis of supramolecular structures with organic molecules, while the amide group can be used to synthesize coordination complexes with inorganic compounds. 4PB has been shown to bind ligands such as nitrogen atoms, frameworks, and coordination complexes. Single crystal x-ray diffraction analysis shows that 4PB has an asymmetric unit composed of two crystallographically independent molecules.Formula:C11H8N2O2Purity:Min. 95%Molecular weight:200.19 g/molRef: 3D-FP149376
Discontinued product4-(Pyrimidin-5-yl)benzoic acid
CAS:Formula:C11H8N2O2Purity:95%Color and Shape:SolidMolecular weight:200.19344-(Pyrimidin-5-yl)benzoic acid
CAS:4-(Pyrimidin-5-yl)benzoic acidPurity:95%Molecular weight:200.19g/mol4-(5-Pyrimidinyl)benzoic acid
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:200.19700622558594