
CAS 21764-09-0: 3′-Hydroxy-5,6,7,4′-tetramethoxyflavone
Formula:C19H18O7
InChI:InChI=1S/C19H18O7/c1-22-13-6-5-10(7-11(13)20)14-8-12(21)17-15(26-14)9-16(23-2)18(24-3)19(17)25-4/h5-9,20H,1-4H3
InChI key:InChIKey=LYLDPYNWDVVPIQ-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(OC(=CC2=O)C3=CC(O)=C(OC)C=C3)=CC(OC)=C1OC
Synonyms:- 2-(3-Hydroxy-4-methoxyphenyl)-5,6,7-trimethoxy-4H-1-benzopyran-4-one
- 2-(3-Hydroxy-4-methoxyphenyl)-5,6,7-trimethoxychromen-4-one
- 2-(3-hydroxy-4-methoxyphenyl)-5,6,7-trimethoxy-4H-chromen-4-one
- 3′-Desmethylsinensetin
- 3′-Hydroxy-4′,5,6,7-tetramethoxyflavone
- 3′-Hydroxy-5,6,7,4′-tetramethoxyflavone
- 4H-1-Benzopyran-4-one, 2-(3-hydroxy-4-methoxyphenyl)-5,6,7-trimethoxy-
- Dr 33
- Eupatorin methyl ether
- Flavone, 3′-hydroxy-4′,5,6,7-tetramethoxy-
Sort by
Found 6 products.
4H-1-Benzopyran-4-one,2-(3-hydroxy-4-methoxyphenyl)-5,6,7-trimethoxy-
CAS:Formula:C19H18O7Purity:95%Color and Shape:SolidMolecular weight:358.3420Eupatorin-5-methylether
CAS:Eupatorin-5-methylether is a natural product for research related to life sciences. The catalog number is TN4039 and the CAS number is 21764-09-0.Formula:C19H18O7Purity:98%Color and Shape:SolidMolecular weight:358.34Eupatorin 5-methyl ether
CAS:Eupatorin 5-methyl ether is a bioactive compound, which is a naturally occurring flavonoid found in certain plant species. This compound is derived from various plants, including those in the Asteraceae family. Eupatorin 5-methyl ether functions primarily through modulating various biochemical pathways, exhibiting anti-inflammatory, antioxidant, and anticancer activities. The specific mode of action involves the inhibition of enzymes and modulation of signaling pathways that are pivotal in the proliferation and survival of cancer cells. It impedes key growth factor receptors and kinases, thereby regulating the cell cycle and promoting apoptosis in malignant cells. Additionally, its antioxidant properties play a crucial role in reducing oxidative stress, a known contributor to numerous chronic diseases. Eupatorin 5-methyl ether is explored extensively in pharmacological and biochemical studies for its potential therapeutic effects. Its applications range across various disciplines, including oncology, where it is evaluated for its efficacy in inhibiting tumor growth, and in chronic disease management due to its anti-inflammatory properties. Researchers continue to investigate its full potential and applicability in the development of new therapeutic agents.Formula:C19H18O7Purity:Min. 95%Color and Shape:PowderMolecular weight:358.34 g/molEupatorin-5-methylether
CAS:Eupatorin-5-methylether analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C19H18O7Purity:(HPLC) ≥95%Color and Shape:PowderMolecular weight:358.35