
CAS 217816-66-5: 3-Bromo-2-fluoro-6-iodobenzonitrile
Formula:C7H2BrFIN
InChI:InChI=1S/C7H2BrFIN/c8-5-1-2-6(10)4(3-11)7(5)9/h1-2H
InChI key:InChIKey=VCRQPVFNRGOPIK-UHFFFAOYSA-N
SMILES:C(#N)C1=C(F)C(Br)=CC=C1I
Synonyms:- Benzonitrile, 3-bromo-2-fluoro-6-iodo-
- 3-Bromo-2-fluoro-6-iodobenzonitrile
Sort by
Found 3 products.
3-Bromo-2-fluoro-6-iodobenzonitrile
CAS:Purity:90.0%Color and Shape:SolidMolecular weight:325.90701293945313-Bromo-2-fluoro-6-iodobenzonitrile
CAS:3-Bromo-2-fluoro-6-iodobenzonitrile (3BI) is a brominated organic compound that has been used in the synthesis of various benzene derivatives, such as terphenyls. The cyano group on the 3BI molecule can be used to cross-couple with other electrophiles, such as bromides and chlorides. This process is efficient because the nucleophilic bromide or chloride can attack the electrophilic cyano group on 3BI, leading to the displacement of iodine and formation of a new carbon-carbon bond. The 3BI molecule also has liquid crystalline properties and can be used as an efficient starting material for synthesizing other compounds.Formula:C7H2BrFINPurity:Min. 95%Molecular weight:325.9 g/molRef: 3D-FB76215
Discontinued product3-Bromo-2-fluoro-6-iodobenzonitrile
CAS:3-Bromo-2-fluoro-6-iodobenzonitrileFormula:C7H2BrFINPurity:95%Color and Shape: faint beige solidMolecular weight:325.90g/mol