
CAS 21969-04-0: 1-bromo-4-(4-nitrophenoxy)benzene
Formula:C12H8BrNO3
InChI:InChI=1/C12H8BrNO3/c13-9-1-5-11(6-2-9)17-12-7-3-10(4-8-12)14(15)16/h1-8H
SMILES:c1cc(ccc1Br)Oc1ccc(cc1)N(=O)=O
Synonyms:- 4-Bromophenyl 4-nitrophenyl ether
- Benzene, 1-Bromo-4-(4-Nitrophenoxy)-
Sort by
Found 4 products.
1-Bromo-4-(4-nitrophenoxy)benzene
CAS:1-Bromo-4-(4-nitrophenoxy)benzenePurity:95Molecular weight:294.10g/mol1-Bromo-4-(4-nitrophenoxy)benzene
CAS:1-Bromo-4-(4-nitrophenoxy)benzene is a copper-catalyzed coupling reaction that produces 1,2,3-triazoles. The reaction involves the coupling of an aryl halide with a triarylphosphine oxide to produce an aryl ether. The catalyst used in this reaction is copper oxide, which is produced by reacting copper with hydrochloric acid and then air. This technique is efficient and can be used to make nanoparticles.Formula:C12H8BrNO3Purity:Min. 95%Molecular weight:294.1 g/mol1-Bromo-4-(4-nitrophenoxy)benzene
CAS:Formula:C12H8BrNO3Purity:95%Color and Shape:SolidMolecular weight:294.1008