
CAS 219873-06-0: 4-Cyano-2-fluorobenzyl alcohol
Formula:C8H6FNO
InChI:InChI=1/C8H6FNO/c9-8-3-6(4-10)1-2-7(8)5-11/h1-3,11H,5H2
SMILES:c1cc(CO)c(cc1C#N)F
Synonyms:- 3-Fluoro-4-(hydroxymethyl)benzonitrile
- 4-Cyano-2-florobenzyl alcohol
Sort by
Found 4 products.
3-Fluoro-4-(hydroxymethyl)benzonitrile
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:151.139999389648444-Cyano-2-fluorobenzyl alcohol
CAS:Formula:C8H6FNOPurity:98%Color and Shape:SolidMolecular weight:151.13773-Fluoro-4-(hydroxymethyl)benzonitrile
CAS:3-Fluoro-4-(hydroxymethyl)benzonitrileFormula:C8H6FNOPurity:98%Color and Shape: faint/pale lemon/gold crystalline powderMolecular weight:151.14g/mol4-Cyano-2-fluorobenzyl alcohol
CAS:4-Cyano-2-fluorobenzyl alcohol is a reagent that is used to produce chlorine and hydrochloric acid. It is also used industrially in the production of potassium chloride, a compound that is used in fertilizers, animal feed supplements, and water treatment. 4-Cyano-2-fluorobenzyl alcohol reacts with chloride ions to form hypochlorous acid (HOCl), which then reacts with water to form hydrogen chloride gas. The reaction with fluoride ions leads to the formation of hydrofluoric acid (HF).Formula:C8H6FNOPurity:Min. 95%Color and Shape:White To Beige SolidMolecular weight:151.14 g/mol