
CAS 2214-53-1: 2-methylpyridine-4-carbonitrile
Formula:C7H6N2
InChI:InChI=1/C7H6N2/c1-6-4-7(5-8)2-3-9-6/h2-4H,1H3
SMILES:Cc1cc(ccn1)C#N
Synonyms:- 4-Cyano-2-Methylpyridine
- 4-Pyridinecarbonitrile, 2-Methyl-
- T6Nj B1 Dcn
Sort by
Found 6 products.
2-Methylisonicotinonitrile
CAS:2-MethylisonicotinonitrileFormula:C7H6N2Purity:96%Color and Shape: beige solidMolecular weight:118.14g/mol4-Cyano-2-methylpyridine
CAS:4-Cyano-2-methylpyridine (4CMP) is a byproduct of the synthesis of bosentan, an antihypertensive agent. 4CMP is an organic compound that has the chemical formula CHN. It is a colorless solid with a melting point of 70 °C and boiling point of 240 °C. 4CMP reacts with water to produce ammonia and hydrogen cyanide gases. The reaction rate increases at higher temperatures and pH levels, as well as in the presence of catalysts such as iron oxide or manganese oxide. In vivo studies have shown that bosentan inhibits blood pressure by reducing the production of nitric oxide from vascular endothelial cells in the lungs. Bosentan also reduces the production of reactive oxygen species and prevents oxidation reactions in cardiac tissue.Formula:C7H6N2Purity:Min. 95%Molecular weight:118.14 g/molRef: 3D-FC20611
Discontinued product2-Methylisonicotinonitrile
CAS:Formula:C7H6N2Purity:98%Color and Shape:SolidMolecular weight:118.13594-Cyano-2-methylpyridine
CAS:Controlled ProductFormula:C7H6N2Color and Shape:NeatMolecular weight:118.14