CAS 2224-00-2: 2-Ethoxy-1-naphthalenecarboxylic acid
Formula:C13H12O3
InChI:InChI=1S/C13H12O3/c1-2-16-11-8-7-9-5-3-4-6-10(9)12(11)13(14)15/h3-8H,2H2,1H3,(H,14,15)
InChI key:InChIKey=MYFBSSDLYGWAHH-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C2=C(C=CC1OCC)C=CC=C2
Synonyms:- 1-Naphthalenecarboxylic acid, 2-ethoxy-
- 1-Naphthoic acid, 2-ethoxy-
- 2-Ethoxy-1-Naphthalenecarboxylic Acid
- 2-Ethoxynaphthalene-1-Carboxylate
- 2-Ethoxynaphthalene-1-Carboxylic Acid
- 2-Ethoxy-1-naphthoic acid
Sort by
Found 10 products.
2-Ethoxy-1-naphthoic acid
CAS:Formula:C13H12O3Purity:98%Color and Shape:SolidMolecular weight:216.23262-Ethoxy-1-naphthoic acid
CAS:2-Ethoxy-1-naphthoic acid is an organic compound that is used in the synthesis of antibiotics, such as nafcillin sodium and cefalexin. It has industrial applications as a solvent and as a reagent for organic reactions. 2-Ethoxy-1-naphthoic acid can be used to produce sulfoxide, peroxide, and chloride by oxidizing the corresponding alcohols. This chemical also has the ability to form reactive intermediates with thionyl chloride or N-chlorosuccinimide. These intermediates can react with other compounds in a way that may lead to allergic reactions or environmental pollution when exposed to air or water. 2-Ethoxy-1-naphthoic acid is soluble in organic solvents such as naphthalene, benzene, and hexane.Formula:C13H12O3Purity:Min. 95%Molecular weight:216.23 g/mol2-Ethoxynaphthoic Acid
CAS:Controlled ProductFormula:C13H12O3Color and Shape:NeatMolecular weight:216.232-Ethoxy-1-naphthoic Acid
CAS:Formula:C13H12O3Purity:>99.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:216.24
