
CAS 2248003-71-4: 1H-1,2,3-Triazole-1-acetamide, N-[4-[[5-fluoro-7-(2-methoxyethoxy)-4-quinazolinyl]amino]phenyl]-4-(1-methylethyl)-, 4-methylbenzenesulfonate (1:1)
Formula:C24H26FN7O3·C7H8O3S
InChI:InChI=1S/C24H26FN7O3.C7H8O3S/c1-15(2)21-12-32(31-30-21)13-22(33)28-16-4-6-17(7-5-16)29-24-23-19(25)10-18(35-9-8-34-3)11-20(23)26-14-27-24;1-6-2-4-7(5-3-6)11(8,9)10/h4-7,10-12,14-15H,8-9,13H2,1-3H3,(H,28,33)(H,26,27,29);2-5H,1H3,(H,8,9,10)
InChI key:InChIKey=AWHHAHZPRULJMA-UHFFFAOYSA-N
SMILES:N(C=1C2=C(C=C(OCCOC)C=C2F)N=CN1)C3=CC=C(NC(CN4C=C(C(C)C)N=N4)=O)C=C3.S(=O)(=O)(O)C1=CC=C(C)C=C1
Synonyms:- AZD3229 tosylate
- 1H-1,2,3-Triazole-1-acetamide, N-[4-[[5-fluoro-7-(2-methoxyethoxy)-4-quinazolinyl]amino]phenyl]-4-(1-methylethyl)-, 4-methylbenzenesulfonate (1:1)
- AZD 3229 tosylate
- N-(4-[[5-Fluoro-7-(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl)-2-[4-(propan-2-yl)-1H-[1,2,3]triazol-1-yl]acetamide tosylate
- AZD-3229 tosylate
Sort by
Found 2 products.
AZD3229 Tosylate
CAS:AZD3229 Tosylate is a small molecule tyrosine kinase inhibitor, which is derived through advanced chemical synthesis methodologies. The compound acts by selectively targeting and inhibiting specific receptor tyrosine kinases, which play a crucial role in the signaling pathways that regulate cellular processes such as proliferation, differentiation, and survival. The compound is primarily investigated for its potential application in oncology, where aberrant kinase activity often underpins tumor growth and metastasis. By obstructing these signaling pathways, AZD3229 Tosylate aims to impede tumor progression and enhance the efficacy of other therapeutic strategies. Its potency and selectivity make it a promising candidate for further research and clinical trials to assess its efficacy and safety in cancer treatment regimens. This molecule's development underscores the ongoing advancements in targeted cancer therapies, which seek to exploit the specific molecular vulnerabilities of cancer cells while minimizing damage to normal tissues.Formula:C31H34FN7O6SPurity:Min. 95%Molecular weight:651.71 g/molAZD3229 Tosylate
CAS:AZD3229 Tosylate is a highly potent inhibitor targeting mutant forms of the pan-KIT enzyme, with a primary application in the treatment of gastrointestinalFormula:C31H34FN7O6SColor and Shape:SolidMolecular weight:651.71