
CAS 22518-06-5: 10-Isobutyryloxy-8,9-epoxythymol isobutyrate
Formula:C18H24O5
InChI:InChI=1S/C18H24O5/c1-11(2)16(19)21-9-18(10-22-18)14-7-6-13(5)8-15(14)23-17(20)12(3)4/h6-8,11-12H,9-10H2,1-5H3
InChI key:InChIKey=OLARKEMZPWGFJU-UHFFFAOYSA-N
SMILES:C(OC(C(C)C)=O)C1(CO1)C2=C(OC(C(C)C)=O)C=C(C)C=C2
Synonyms:- Propanoic acid, 2-methyl-, 5-methyl-2-[2-[(2-methyl-1-oxopropoxy)methyl]-2-oxiranyl]phenyl ester
- Propanoic acid, 2-methyl-, 5-methyl-2-[2-[(2-methyl-1-oxopropoxy)methyl]oxiranyl]phenyl ester
- 10-Isobutyryloxy-8,9-epoxythymol isobutyrate
- Isobutyric acid, diester with 2,3-epoxy-2-(2-hydroxy-p-tolyl)-1-propanol
Sort by
Found 4 products.
10-Isobutyryloxy-89-epoxythymyl isobutyrate
CAS:10-Isobutyryloxy-89-epoxythymyl isobutyrate is a bioactive compound, categorized as a naturally derived chemical. This compound is extracted from plant sources known for their therapeutic potential, specifically those related to the thymol family. The mode of action of 10-Isobutyryloxy-89-epoxythymyl isobutyrate primarily involves its interaction with microbial cell membranes, leading to disruption of cellular processes and ultimately microbial inhibition or death. Its structure suggests a potential for disrupting biofilms and inhibiting the growth of various pathogens, making it a promising candidate for antimicrobial applications. The uses and applications of 10-Isobutyryloxy-89-epoxythymyl isobutyrate are being explored in various scientific contexts, particularly within the fields of microbiology, pharmacology, and natural product chemistry. Its potential to serve as a natural preservative or a component in antimicrobial formulations is of significant interest, especially in the development of new therapeutic agents. Further research is required to fully elucidate its efficacy, safety profile, and potential in clinical settings.Formula:C18H24O5Purity:Min. 95%Molecular weight:320.38 g/mol10-Isobutyryloxy-8,9-epoxythymol isobutyrate
CAS:10-Isobutyryloxy-8,9-epoxythymol isobutyrate is a major constituent of Inula helenium and Inula royleana root cultures.Formula:C18H24O5Purity:98%Color and Shape:SolidMolecular weight:320.38