CAS 22570-53-2: Zeorin
Formula:C30H52O2
InChI:InChI=1S/C30H52O2/c1-25(2)14-9-15-28(6)23-11-10-22-27(5)16-12-19(26(3,4)32)20(27)13-17-29(22,7)30(23,8)18-21(31)24(25)28/h19-24,31-32H,9-18H2,1-8H3/t19-,20-,21-,22+,23+,24-,27-,28+,29+,30+/m0/s1
InChI key:InChIKey=KYBLAIAGFNCVHL-PMVHANJISA-N
SMILES:C[C@]12[C@@]([C@]3(C)[C@@]([C@@H](O)C1)(C(C)(C)CCC3)[H])(CC[C@]4([C@@]2(C)CC[C@@]5([C@]4(C)CC[C@@H]5[C@](C)(C)O)[H])[H])[H]
Synonyms:- 1H-Cyclopenta[a]chrysene, A′-neogammacerane-6,22-diol deriv.
- (6α)-A′-Neogammacerane-6,22-diol
- Zeorin
- A′-Neogammacerane-6,22-diol, (6α)-
- A′-Neo-21βH-gammacerane-6α,22-diol
- See more synonyms
Sort by
Found 3 products.
Zeorin
CAS:Zeorin inhibits bacteria, fungi, and reduces histamine release by 40% from mast cells.Formula:C30H52O2Purity:98%Color and Shape:SolidMolecular weight:444.73Zeorin
CAS:Controlled ProductZeorin is a triterpenoid biomolecule, which is a secondary metabolite derived from various botanical and lichen sources. This compound exhibits a complex molecular structure typical of triterpenoids, characterized by a carbon skeleton of isoprene units. Zeorin interacts with cellular pathways through modulation of signaling mechanisms and potential antioxidant activity. Its role in regulating inflammatory responses and cellular oxidative stress is under investigation, highlighting its biochemical versatility. In scientific research, Zeorin is primarily utilized for its potential in pharmacological and biochemical studies. Its applications span the exploration of anti-inflammatory and antioxidant effects, serving as a model compound in studies of natural product chemistry and bioactivity. Additionally, Zeorin's capability to engage with specific cellular pathways makes it a valuable subject in the development of therapeutic agents. The compound's unique properties also make it a point of interest in the study of ecological interactions within its native lichen sources.Formula:C30H52O2Purity:Min. 95%Molecular weight:444.39673
