
CAS 2264-03-1: Perfluoropentadecane
Formula:C15F32
InChI:InChI=1/C15F32/c16-1(17,2(18,19)4(22,23)6(26,27)8(30,31)10(34,35)12(38,39)14(42,43)44)3(20,21)5(24,25)7(28,29)9(32,33)11(36,37)13(40,41)15(45,46)47
SMILES:C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
Sort by
Found 5 products.
Perfluoropentadecane
CAS:PerfluoropentadecanePurity:95%Color and Shape:SolidMolecular weight:788.11g/molDotriacontafluoropentadecane
CAS:Controlled ProductDotriacontafluoropentadecane is a chemical compound that belongs to the group of perfluoroalkyls. It is structurally related to crotonic acid, which has been shown to facilitate the reaction mechanism of radiation and fluorine. Dotriacontafluoropentadecane has been shown to be a good facilitator in polymerization reactions. The presence of phenyl groups on this molecule allows for its easy removal by hydrogenolysis. This compound can also react with oxygen to form an alkyl radical and a hydroxyl radical. Its spatial arrangement makes it suitable as a monomer or initiator for polymers, and its functional groups allow it to bind with other compounds, such as polymers or metal ions.Formula:C15F32Purity:Min. 95%Molecular weight:788.11 g/mol