
CAS 22934-99-2: 5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-6-methoxy-4H-chromen-4-one
Formula:C17H14O7
InChI:InChI=1/C17H14O7/c1-22-12-4-3-8(5-9(12)18)13-6-10(19)15-14(24-13)7-11(20)17(23-2)16(15)21/h3-7,18,20-21H,1-2H3
SMILES:COc1ccc(cc1O)c1cc(=O)c2c(cc(c(c2O)OC)O)o1
Synonyms:- 4H-1-benzopyran-4-one, 5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-6-methoxy-
- Desmethoxycentaureidin
Sort by
Found 4 products.
3-Desmethoxycentaureidin
CAS:Formula:C17H14O7Purity:95%~99%Color and Shape:Yeollow powderMolecular weight:330.292Desmethoxycentaureidin
CAS:Desmethoxycentaureidin shows high inhibitory activity against HeLa cell growth (GI50 9 microM).Formula:C17H14O7Purity:98%Color and Shape:SolidMolecular weight:330.29Desmethoxycentaureidin
CAS:Desmethoxycentaureidin is a flavonoid compound, which is a naturally occurring polyphenolic substance. It is primarily sourced from various plant species and contributes to their defense mechanisms against environmental stressors. Flavonoids, including Desmethoxycentaureidin, are synthesized through the phenylpropanoid pathway, a crucial biosynthetic route in plants that produces a plethora of aromatic secondary metabolites. The mode of action of Desmethoxycentaureidin involves its function as an antioxidant, where it scavenges free radicals and chelates metal ions, thereby inhibiting oxidative stress. This mechanism is critical for protecting cellular components from oxidative damage, which can lead to cellular dysfunction and contribute to the development of various diseases. In the realm of applications, Desmethoxycentaureidin is primarily studied for its potential therapeutic benefits. It is of interest in the development of pharmaceuticals aimed at reducing oxidative stress-related disorders and is also being explored for its role in cancer prevention. Furthermore, due to its antioxidant properties, it finds applications in cosmetic formulations designed to protect skin tissues from oxidative damage and premature aging. The ongoing research into its diverse bioactivities continues to highlight its significance in both scientific and medical fields.Formula:C17H14O7Purity:Min. 95%Molecular weight:330.29 g/mol