
CAS 2345-32-6: 4,4,4-trichlorobutyric acid
Formula:C4H5Cl3O2
InChI:InChI=1S/C4H5Cl3O2/c5-4(6,7)2-1-3(8)9/h1-2H2,(H,8,9)
InChI key:InChIKey=KXPULUVMTDIQOQ-UHFFFAOYSA-N
SMILES:C(C(Cl)(Cl)Cl)CC(O)=O
Synonyms:- 4,4,4-Trichlorobutanoic acid
- Butanoic acid, 4,4,4-trichloro-
- Butyric acid, 4,4,4-trichloro-
Sort by
Found 3 products.
Butanoic acid, 4,4,4-trichloro-
CAS:Formula:C4H5Cl3O2Purity:98%Color and Shape:SolidMolecular weight:191.44034,4,4-Trichlorobutyric Acid
CAS:4,4,4-Trichlorobutyric acid is a trichloromethyl derivative of an aliphatic fatty acid. It is a colorless liquid that has a melting point of -76°C and a boiling point of 105°C. The compound is used as an optical isomer for the production of carboxylic acids and esters. Its benzyl group makes it soluble in organic solvents such as ether or chloroform. 4,4,4-Trichlorobutyric acid can be used as an acid catalyst for the esterification reaction of alcohols with carboxylic acids. It yields high yields when esterifying propionic acid with benzyl alcohol.Formula:C4H5O2Cl3Purity:Min. 95%Molecular weight:191.44 g/mol