Methyl 12-oxooctadecanoate, with the CAS number 2380-27-0, is an ester derived from the fatty acid octadecanoic acid (commonly known as stearic acid) and methanol. This compound features a carbon chain of 18 carbon atoms, with a ketone functional group located at the 12th carbon position. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. Methyl 12-oxooctadecanoate is characterized by its relatively high molecular weight and hydrophobic nature, making it insoluble in water but soluble in organic solvents. It may exhibit properties typical of fatty acid esters, such as low volatility and stability under normal conditions. This compound can be of interest in various applications, including as a potential intermediate in organic synthesis, in the production of surfactants, or in the formulation of cosmetic and personal care products. Its specific reactivity and interactions would depend on the presence of the ketone group, which can participate in various chemical reactions.

methyl 12-oxooctadecanoate

2380-27-0: Octadecanoic acid, 12-oxo-, methyl ester

Methyl 12-ketostearate is an organic compound with the formula CH(CH)COCH=CHCOCH=CHCOOCH3. It is a colorless liquid with a fishy odor. The compound is used as a precursor to other compounds, such as esters and amides. It can be prepared by the reaction of methyl mercaptoacetate and copper chromite in dimethylformamide: Methyl 12-ketostearate + CuCrO4 → Methyl 12-ketostearate + CuCrO4 → Methyl 12-ketostearate + CuCrO4 → Methyl 12-ketostearate + CuCrO4 → Methyl 12-ketostearate + CuCrO4 → Methyl 12-ketostearate + CuCrO4 →

CAS 2380-27-0: methyl 12-oxooctadecanoate

Methyl 12-ketostearate

Ref: 3D-FM25372

Methyl 12-Oxooctadecanoate

Ref: 48-23-1812

Methyl 12-oxooctadecanoate

Ref: IN-DA003RJQ

Methyl 12-Ketostearate

Ref: 4Z-S-057006

Methyl 12-Ketostearate

Ref: TR-M315090