
CAS 23936-04-1: 4-(2-Hydroxyethyl)-2-piperazinone
Formula:C6H12N2O2
InChI:InChI=1S/C6H12N2O2/c9-4-3-8-2-1-7-6(10)5-8/h9H,1-5H2,(H,7,10)
InChI key:InChIKey=DPUICVIJDAOKBK-UHFFFAOYSA-N
SMILES:C(CO)N1CC(=O)NCC1
Synonyms:- Piperazinone, 4-(2-hydroxyethyl)-
- 4-(2-Hydroxyethyl)-2-piperazinone
- N-(2-Hydroxyethyl)piperazin-3-one
- 2-Piperazinone, 4-(2-hydroxyethyl)-
Sort by
Found 5 products.
4-(2-Hydroxyethyl)piperazin-2-one (may contain up to 15% inorganics)
CAS:Applications 4-(2-Hydroxyethyl)piperazin-2-one (cas# 23936-04-1) is a useful research chemical.Formula:C6H12N2O2Color and Shape:Off-White to Pale Yellow SolidMolecular weight:144.174-(2-Hydroxyethyl)-piperazin-2-one
CAS:4-(2-Hydroxyethyl)-piperazin-2-oneFormula:C6H12N2O2Purity:96%Color and Shape: off-white solidMolecular weight:144.17g/mol4-(2-Hydroxyethyl)piperazin-2-one
CAS:4-(2-Hydroxyethyl)piperazin-2-one is a versatile compound that has various applications in the field of research and chemical synthesis. It is commonly used as an intermediate in the synthesis of fatty acids, carotenoids, and amides. This compound exhibits a nematic phase, which makes it useful in liquid crystal displays and other electronic devices. In addition to its role in chemical synthesis, 4-(2-Hydroxyethyl)piperazin-2-one also acts as a protonation agent and can form stable complexes with carbene and quinoline derivatives. It is often employed as an organozinc reagent in cross-coupling reactions, facilitating the formation of carbon-carbon bonds. Furthermore, this compound has been studied for its potential as an inhibitor of molybdenum enzymes. Its electrostatic interactions with carboxylate groups make it an effective inhibitor of these enzymes, which play crucial roles in various biological processes. Overall, 4-(Formula:C6H12N2O2Purity:Min. 95%Molecular weight:144.17 g/mol