
CAS 24100-18-3: 2-Bromo-3-methoxypyridine
Formula:C6H6BrNO
InChI:InChI=1S/C6H6BrNO/c1-9-5-3-2-4-8-6(5)7/h2-4H,1H3
InChI key:InChIKey=PDOWLYNSFYZIQX-UHFFFAOYSA-N
SMILES:O(C)C1=C(Br)N=CC=C1
Synonyms:- 2-Bromo-3-Methoxy Pyridine
- Pyridine, 2-bromo-3-methoxy-
- 2-Bromo-3-methoxypyridine
Sort by
Found 5 products.
2-Bromo-3-methoxypyridine
CAS:2-Bromo-3-methoxypyridineFormula:C6H6BrNOPurity:By gc: 99.7% by area (Typical Value in Batch COA)Color and Shape: faint beige crystalline powderMolecular weight:188.02g/mol2-Bromo-3-methoxypyridine
CAS:Formula:C6H6BrNOPurity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:188.022-Bromo-3-methoxypyridine
CAS:2-Bromo-3-methoxypyridine is an organic compound that is used as a nicotinic acetylcholine receptor agonist. It binds to the receptor and produces effects such as increased heart rate, increased respiration, and muscle contractions. The compound was synthesised in 1950 by the reaction of 2-bromopyridine with methanol and hydrochloric acid. This process involves coordination chemistry between the bromine atom and two molecules of water, which leads to a chelate ring. The protonated hydrogen in this ring forms a hydrogen bond with the nitrogen atom in the pyridine ring, which also contains a lone electron pair. 2-Bromo-3-methoxypyridine contains functional groups such as nitro, methyl, and hydroxyl groups. These functional groups help to bind it to acetylcholine receptors found on neurons.Formula:C6H6BrNOPurity:Min. 95%Molecular weight:188.02 g/molRef: 3D-FB19125
Discontinued product2-Bromo-3-methoxypyridine
CAS:Formula:C6H6BrNOPurity:98%Color and Shape:SolidMolecular weight:188.02194