
CAS 24123-92-0: Koenidine
Formula:C20H21NO3
InChI:InChI=1S/C20H21NO3/c1-11-8-14-13-9-16(22-4)17(23-5)10-15(13)21-18(14)12-6-7-20(2,3)24-19(11)12/h6-10,21H,1-5H3
InChI key:InChIKey=IUZVYLWUISSZCS-UHFFFAOYSA-N
SMILES:CC=1C=C2C(=C3C1OC(C)(C)C=C3)NC=4C2=CC(OC)=C(OC)C4
Synonyms:- 3,11-Dihydro-8,9-dimethoxy-3,3,5-trimethylpyrano[3,2-a]carbazole
- Pyrano[3,2-a]carbazole, 3,11-dihydro-8,9-dimethoxy-3,3,5-trimethyl-
- Kenimbidine
- Kenidine
- Kenigicine
Sort by
Found 2 products.
Koenigicine
CAS:Koenigicine is an alkaloid, a type of naturally occurring chemical compound usually containing basic nitrogen atoms. It is derived from the plant species of the Murraya genus, which are commonly found in tropical Asia. The compound is isolated from various plant parts through techniques such as solvent extraction and chromatography. Koenigicine exerts its effects primarily through interaction with microbial cell structures, disrupting cell wall synthesis or function, leading to the inhibition of growth or destruction of the microbial cells. This mode of action makes it a promising candidate for antimicrobial research. The compound's uses and applications are centered on its potential as an antimicrobial agent. Scientists are actively researching its efficacy and safety in treating infections caused by bacteria and molds. Moreover, its role in modulating biological pathways opens avenues for broader pharmacological applications. However, comprehensive studies and clinical trials are essential to fully understand its scope and limitations in medical and therapeutic contexts.Formula:C20H21NO3Purity:Min. 95%Molecular weight:323.4 g/molKoenigicine
CAS:Natural alkaloidFormula:C20H21NO3Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:323.39