
CAS 243472-69-7: 2-bromo-5-phenylpyrazine
Formula:C10H7BrN2
InChI:InChI=1/C10H7BrN2/c11-10-7-12-9(6-13-10)8-4-2-1-3-5-8/h1-7H
SMILES:c1ccc(cc1)c1cnc(cn1)Br
Sort by
Found 3 products.
2-Bromo-5-phenylpyrazine
CAS:2-Bromo-5-phenylpyrazine is an organic compound that belongs to the acylpyridine class. This chemical has acidic properties and undergoes hydrolysis to form phenylacetic acid and 2-bromo-5-phenylacetic acid. The optimal reaction for this process is conducted in an aqueous medium with a base, such as sodium hydroxide or potassium hydroxide. This chemical can also be synthesized from ketones by cross-coupling reactions with organotin compounds, such as tributyltin oxide.Formula:C10H7BrN2Purity:Min. 95%Molecular weight:235.08 g/mol