CAS 2438-04-2: 2-(propan-2-yl)benzoic acid
Formula:C10H12O2
InChI:InChI=1/C10H12O2/c1-7(2)8-5-3-4-6-9(8)10(11)12/h3-7H,1-2H3,(H,11,12)
SMILES:CC(C)c1ccccc1C(=O)O
Synonyms:- 2-Isopropylbenzoic Acid
- Benzoic acid, 2-(1-methylethyl)-
- o-Isopropylbenzoic acid
Sort by
Found 6 products.
2-Isopropylbenzoic Acid
CAS:Formula:C10H12O2Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:164.202-Isopropylbenzoic acid
CAS:2-Isopropylbenzoic acid is a fine chemical that belongs to the group of aromatic compounds and has the molecular formula C8H10O2. This compound is used in research as an intermediate for organic synthesis, such as the production of pharmaceuticals. 2-Isopropylbenzoic acid is also a versatile building block for complex molecules, such as dyes and fragrances. It can be used as a reagent or speciality chemical in research and development, such as in polymer chemistry. 2-Isopropylbenzoic acid can be used as a reaction component for synthesis of other chemicals, such as pharmaceuticals. As an intermediate, it can be used in the production of synthetic drugs and other bioactive molecules that are difficult to synthesize by other means due to its high quality.Formula:C10H12O2Purity:Min. 95%Color and Shape:White PowderMolecular weight:164.2 g/mol2-propan-2-ylbenzoic acid
CAS:Formula:C10H12O2Purity:98%Color and Shape:SolidMolecular weight:164.2011
