CAS 24552-27-0: 3-Chloropropionic Acid Phenyl Ester
Formula:C9H9ClO2
InChI:InChI=1/C9H9ClO2/c10-7-6-9(11)12-8-4-2-1-3-5-8/h1-5H,6-7H2
SMILES:c1ccc(cc1)OC(=O)CCCl
Synonyms:- Phenyl beta-chloropropionate
- Phenyl 3-Chloropropanoate
Sort by
Found 5 products.
3-Chloropropionic acid phenyl ester
CAS:3-Chloropropionic acid phenyl ester is a nitrous compound that is commonly used in research chemicals. It acts as an accelerator for nitrate-based reactions, increasing the hydration rate of certain compounds. This chemical also has anti-freezing properties and can be used as an additive to prevent freezing in various applications. The presence of a carbonyl group and a hydrogen atom in its structure allows for rapid hydration, resulting in an increased reaction rate. 3-Chloropropionic acid phenyl ester has been studied extensively using techniques such as dispersive spectroscopy to understand its physicochemical properties, including its behavior in the amorphous phase and its interaction with nitrite compounds.Formula:C9H9ClO2Purity:Min. 95%Molecular weight:184.62 g/molPropanoic acid, 3-chloro-, phenyl ester
CAS:Formula:C9H9ClO2Purity:95%Color and Shape:LiquidMolecular weight:184.61956Phenyl 3-Chloropropionate
CAS:Formula:C9H9ClO2Purity:>95.0%(GC)Color and Shape:Colorless to Light yellow to Light orange clear liquidMolecular weight:184.623-Chloropropionic acid phenyl ester
CAS:3-Chloropropionic acid phenyl esterPurity:97%Molecular weight:184.62g/mol
