
CAS 24973-59-9: 2,4,6-Tri-tert-butylnitrosobenzene
Formula:C18H29NO
InChI:InChI=1S/C18H29NO/c1-16(2,3)12-10-13(17(4,5)6)15(19-20)14(11-12)18(7,8)9/h10-11H,1-9H3
InChI key:InChIKey=OSICDPWAPKXXHT-UHFFFAOYSA-N
SMILES:N(=O)C1=C(C(C)(C)C)C=C(C(C)(C)C)C=C1C(C)(C)C
Synonyms:- 1,3,5-Tris(1,1-dimethylethyl)-2-nitrosobenzene
- 1,3,5-Tritert-butyl-2-nitrosobenzene
- 1-Nitroso-2,4,6-tri-t-butylbenzene
- 2,4,6-Tri-tert-butyl-1-nitrosobenzene
- 2,4,6-Tri-tert-butylnitrosobenzene
- Benzene, 1,3,5-tri-tert-butyl-2-nitroso-
- Benzene, 1,3,5-tris(1,1-dimethylethyl)-2-nitroso-
- Nsc 677542
- 1,3,5-Tri(tert-butyl)-2-nitrosobenzene
Sort by
Found 3 products.
2,4,6-Tri-tert-butylnitrosobenzene
CAS:2,4,6-Tri-tert-butylnitrosobenzene is a research chemical with various applications. It can be used to study the interaction between ganglioside GM2 and other compounds. This compound is also commonly used in electrode fabrication for its excellent electrical conductivity properties. Additionally, 2,4,6-Tri-tert-butylnitrosobenzene has been found to have potential as an intermediate in the synthesis of diclofenac, a nonsteroidal anti-inflammatory drug. Its benzylic reactivity makes it useful in the development of pyrazosulfuron herbicides. Furthermore, this compound can be utilized in the production of antibodies due to its ability to conjugate with phosphoric groups. Its water-soluble nature makes it suitable for various applications in different fields such as pharmaceuticals (e.g., cefpodoxime proxetil), fatty acid synthesis, cellulose modification, and enhancing bioavailability of certain compoundsFormula:C18H29NOPurity:Min. 95%Molecular weight:275.44 g/molBenzene, 1,3,5-tris(1,1-dimethylethyl)-2-nitroso-
CAS:Formula:C18H29NOPurity:98%Color and Shape:SolidMolecular weight:275.42895999999992,4,6-Tri-tert-butylnitrosobenzene
CAS:Formula:C18H29NOPurity:>98.0%(GC)Color and Shape:White to Green to Blue powder to crystalMolecular weight:275.44