
CAS 25151-07-9: 5-Chloro-2,4-difluoropyrimidine
Formula:C4HClF2N2
InChI:InChI=1/C4HClF2N2/c5-2-1-8-4(7)9-3(2)6/h1H
SMILES:c1c(c(F)nc(F)n1)Cl
Sort by
Found 5 products.
Pyrimidine, 5-chloro-2,4-difluoro-
CAS:Formula:C4HClF2N2Purity:98%Color and Shape:LiquidMolecular weight:150.51395-Chloro-2,4-difluoropyrimidine
CAS:5-Chloro-2,4-difluoropyrimidineFormula:C4HClF2N2Purity:97%Color and Shape: colourless liquidMolecular weight:150.51g/mol5-Chloro-2,4-Difluoropyrimidine
CAS:5-Chloro-2,4-difluoropyrimidine is a reactive compound that has two hydroxyl groups and a chlorine atom. It reacts with sodium carbonate to form the sodium salt. This reaction is an example of a covalent bond. 5-Chloro-2,4-difluoropyrimidine reacts with chlorine to form the ion pair. This reaction can be amide or sulfate mediated. In the presence of water, 5-chloro-2,4-difluoropyrimidine forms the phenolic compound hydroxylamine. The temperature at which this reaction occurs is important because it affects the rate of reaction and also the product distribution of the reaction.Formula:C4HClF2N2Purity:Min. 95%Molecular weight:150.51 g/molRef: 3D-FC79970
Discontinued product5-Chloro-2,4-difluoropyrimidine
CAS:Controlled ProductFormula:C4HClF2N2Color and Shape:NeatMolecular weight:150.514