
CAS 252372-09-1: 1-furan-3-ylethanamine
Formula:C6H9NO
InChI:InChI=1/C6H9NO/c1-5(7)6-2-3-8-4-6/h2-5H,7H2,1H3
SMILES:CC(c1ccoc1)N
Synonyms:- 1-(3-Furyl)ethanamin
- 1-(3-Furyl)Ethanamine
- 3-Furanmethanamine, Α-Methyl-
Sort by
Found 5 products.
1-Furan-3-yl-ethylamine oxalate
CAS:1-Furan-3-yl-ethylamine oxalate is a heterocyclic compound that belongs to the class of heterocyclic compounds. It is an oxime, which is a chemical compound that contains both amine and ketone functional groups. The 1-furan-3-yl group is sequentially linked to the ethylamine group. The heterocyclic compounds are typically found in chemistry or biology. They are often used as starting materials for synthesis of other compounds, such as pharmaceuticals. 1-Furan-3-yl-ethylamine oxalate has been shown to be effective in the translation process by inhibiting methylimine formation during protein synthesis.Formula:C6H9NO·C2H2O4Purity:Min. 95%Molecular weight:201.18 g/molRef: 3D-FF51404
Discontinued product1-Furan-3-yl-ethylamine
CAS:1-Furan-3-yl-ethylamineFormula:C6H9NOPurity:96%Color and Shape: yellowish liquidMolecular weight:111.14g/mol