
CAS 25510-41-2: 29H,31H-Phthalocyanine, lithium salt (1:2)
Formula:C32H18N8·2Li
InChI:InChI=1S/C32H18N8.2Li/c1-2-10-18-17(9-1)25-33-26(18)38-28-21-13-5-6-14-22(21)30(35-28)40-32-24-16-8-7-15-23(24)31(36-32)39-29-20-12-4-3-11-19(20)27(34-29)37-25;;/h1-16H,(H2,33,34,35,36,37,38,39,40);;
InChI key:InChIKey=VEGOPYLKEARSAH-UHFFFAOYSA-N
SMILES:C=12C(=C3NC1NC=4C=5C(C(N4)=NC=6C=7C(C(=NC8=NC(=N3)C=9C8=CC=CC9)N6)=CC=CC7)=CC=CC5)C=CC=C2.[Li]
Synonyms:- 29H,31H-Phthalocyanine, dilithium salt
- 29H,31H-Phthalocyanine, lithium salt (1:2)
- Dilithium Phthalocyanine-29,30-Diide
- Lithium, [phthalocyaninato(2-)]di-
- Nsc 338962
- Phthalocyanine, dilithium deriv.
- Phthalocyanine, dilithium salt
- Phthalocyanine-29,30-Diide
Sort by
Found 4 products.
Dilithium phthalocyanine
CAS:Dilithium phthalocyanine is a low-energy metathesis catalyst that is used in the synthesis of organic compounds. It is a coordination complex that has been shown to have a high chemical stability and to be resistant to radiation. The mechanism of action of dilithium phthalocyanine involves the formation of a covalent bond between two molecules or ions. The activation energy for this reaction is relatively low, making it an ideal catalyst for reactions involving ether linkages in which the hydrochloric acid acts as the base. One example of such a reaction is the synthesis of phthalocyanines from lithium and hydrogen chloride.Purity:93%MinDILITHIUM PHTHALOCYANINE
CAS:Formula:C32H18LiN8Purity:93%Color and Shape:SolidMolecular weight:521.4799Dilithium Phthalocyanine
CAS:Formula:C32H16Li2N8Purity:>93.0%(N)Color and Shape:Dark green to Dark purple to Black powder to crystalMolecular weight:526.42