
CAS 25563-02-4: 2-Phenoxyphenylacetic acid
Formula:C14H12O3
InChI:InChI=1/C14H12O3/c15-14(16)10-11-6-4-5-9-13(11)17-12-7-2-1-3-8-12/h1-9H,10H2,(H,15,16)
SMILES:c1ccc(cc1)Oc1ccccc1CC(=O)O
Sort by
Found 4 products.
2-(2-Phenoxyphenyl)acetic acid
CAS:Formula:C14H12O3Purity:95%Color and Shape:SolidMolecular weight:228.24332-(2-Phenoxyphenyl)acetic acid
CAS:2-(2-Phenoxyphenyl)acetic acid is a synthetic antibiotic with immunosuppressant properties. It has been shown to be effective against carrageenan-induced rat paw edema, which is caused by the release of formyl peptides from mast cells and macrophages in response to inflammatory agents. 2-(2-Phenoxyphenyl)acetic acid also has proton pump inhibitory effects, which can lead to relief from peptic ulcers. This drug has been shown to be an antagonist at the benzodiazepine receptor and may have potential for use as a muscle relaxant or sleep aid. 2-(2-Phenoxyphenyl)acetic acid is metabolized by sulfonation and hydrolysis of the acetate moiety, leading to its active form phenoxyacetic acid. This drug is orally bioavailable, but it is not known if it crosses the blood-brain barrier.Formula:C14H12O3Purity:Min. 95%Molecular weight:228.24 g/molRef: 3D-FP55191
Discontinued product