
CAS 2563-26-0: 4,5-Dibromo-1,2-benzenediol
Formula:C6H4Br2O2
InChI:InChI=1/C6H4Br2O2/c7-3-1-5(9)6(10)2-4(3)8/h1-2,9-10H
SMILES:c1c(c(cc(c1O)O)Br)Br
Synonyms:- 1,2-Benzenediol, 4,5-Dibromo-
- 4,5-Dibromobenzene-1,2-diol
- Benzen-1,2-diol, 4,5-dibromo-
Sort by
Found 7 products.
4,5-Dibromobenzene-1,2-diol
CAS:Formula:C6H4Br2O2Purity:97%Color and Shape:SolidMolecular weight:267.90284,5-Dibromobenzene-1,2-diol
CAS:4,5-Dibromobenzene-1,2-diol is a chemical compound that contains one bromine atom and two hydroxyl groups. It is synthesized by the Suzuki coupling reaction of 4,5-dibromobenzene and formaldehyde. This compound has been used in various reactions including nucleophilic substitution, reductive amination, and Friedel-Crafts reactions. This chemical has also been extensively studied for its phase transition temperature and techniques for purification. The metal ion can be bound to the molecule through coordination or chelation. The metal cation can be selectively removed from the molecule by heating it in an acid environment at temperatures below 100°C. 4,5-Dibromobenzene-1,2-diol is usually found as an off white solid that crystallizes in either a monoclinic or orthorhombic crystal structure depending on the solvent used.Formula:C6H4Br2O2Purity:Min. 95%Molecular weight:267.9 g/mol