
CAS 2622-67-5: 1,2-Diphenylbenzimidazole
Formula:C19H14N2
InChI:InChI=1/C19H14N2/c1-3-9-15(10-4-1)19-20-17-13-7-8-14-18(17)21(19)16-11-5-2-6-12-16/h1-14H
SMILES:c1ccc(cc1)c1nc2ccccc2n1c1ccccc1
Synonyms:- 1,2-Diphenyl-1H-Benzimidazole
Sort by
Found 3 products.
1,2-Diphenyl-1H-benzimidazole
CAS:1,2-Diphenyl-1H-benzimidazole is a heterocyclic organic compound that has two phenyl groups and two hydrogen atoms. It is an electron acceptor and has a redox potential of -0.8 V. It also has the ability to undergo photophysical reactions. The molecule's chemical reactions depend on the presence of ancillary functional groups, which are electron donating or withdrawing groups. 1,2-Diphenyl-1H-benzimidazole can be used as a reagent in organic synthesis due to its functional groups.Formula:C19H14N2Purity:Min. 95%Color and Shape:SolidMolecular weight:270.33 g/mol1H-Benzimidazole, 1,2-diphenyl-
CAS:Formula:C19H14N2Purity:95%Color and Shape:SolidMolecular weight:270.3279