CAS 263016-08-6: ethyl 2-(4-chlorophenyl)-4-hydroxy-1,3-thiazole-5-carboxylate
Formula:C12H10ClNO3S
InChI:InChI=1/C12H10ClNO3S/c1-2-17-12(16)9-10(15)14-11(18-9)7-3-5-8(13)6-4-7/h3-6,15H,2H2,1H3
SMILES:CCOC(=O)c1c(nc(c2ccc(cc2)Cl)s1)O
Sort by
Found 4 products.
5-Thiazolecarboxylic acid, 2-(4-chlorophenyl)-4-hydroxy-, ethyl ester
CAS:Formula:C12H10ClNO3SColor and Shape:SolidMolecular weight:283.7307Ethyl 2-(4-chlorophenyl)-4-hydroxy-1,3-thiazole-5-carboxylate
CAS:Ethyl 2-(4-chlorophenyl)-4-hydroxy-1,3-thiazole-5-carboxylateMolecular weight:283.73g/mol2-(4-Chloro-phenyl)-4-hydroxy-thiazole-5-carboxylic acid ethyl ester
CAS:Purity:95.0%Molecular weight:283.7300109863281Ethyl 2-(4-chlorophenyl)-4-hydroxythiazole-5-carboxylate
CAS:Ethyl 2-(4-chlorophenyl)-4-hydroxythiazole-5-carboxylate is a versatile compound that belongs to the steroid group of research chemicals. It has various applications in organic synthesis and is commonly used in the production of coumarins, perfluoroalkyl compounds, pyrazoles, and pyrazines. This compound can be synthesized through methods such as aromatic ketone acetylation and chlorination reactions. Ethyl 2-(4-chlorophenyl)-4-hydroxythiazole-5-carboxylate is known for its role as an inhibitor in certain biological processes. It exhibits inhibitory effects on specific enzymes or proteins, making it valuable in drug discovery and development. Additionally, this compound has been studied for its potential therapeutic properties, particularly in relation to its interaction with tripterygium extracts. With its diverse range of applications and potential benefits, Ethyl 2-(4-chlorophenyl)-Purity:Min. 95%
