
CAS 26456-05-3: 10-methylacridinium perchlorate
Formula:C14H12ClNO4
InChI:InChI=1/C14H12N.ClHO4/c1-15-13-8-4-2-6-11(13)10-12-7-3-5-9-14(12)15;2-1(3,4)5/h2-10H,1H3;(H,2,3,4,5)/q+1;/p-1
Synonyms:- 10-Methylacridinium Perchlorate
Sort by
Found 5 products.
10-Methylacridinium Perchlorate
CAS:10-Methylacridinium PerchloratePurity:95%Molecular weight:293.70g/mol10-Methylacridinium Perchlorate
CAS:Formula:C14H12ClNO4Purity:>98.0%(N)Color and Shape:Light yellow to Amber to Dark green powder to crystalMolecular weight:293.7010-Methylacridinium perchlorate
CAS:10-Methylacridinium perchlorate is a yellow, water-soluble compound with a molecular weight of 236.06. It is an oxygenated organometallic compound that contains a dodecyl group and two phenyl substituents on the acridinium moiety. It has been shown to undergo photooxidation in the presence of oxygen and light to form an aldehyde and CO2. 10-Methylacridinium perchlorate also undergoes bond cleavage, hydride transfer, or redox potential changes when it is in contact with various reactants such as acetonitrile or acetic acid. The reaction rate for this chemical can be predicted by the functional theory based on its constant properties.Formula:C14H12N·ClO4Purity:Min. 95%Molecular weight:293.71 g/molAcridinium, 10-methyl-, perchlorate (1:1)
CAS:Formula:C14H12ClNO4Purity:97%Color and Shape:SolidMolecular weight:293.7024