
CAS 268541-26-0: Triptohypol F
Formula:C31H52O2
InChI:InChI=1S/C31H52O2/c1-26(2)14-15-28(5)16-17-30(7)20(21(28)19-26)18-22(33-9)25-29(6)12-11-24(32)27(3,4)23(29)10-13-31(25,30)8/h18,21-25,32H,10-17,19H2,1-9H3/t21-,22+,23-,24-,25+,28+,29-,30+,31+/m0/s1
InChI key:InChIKey=VKGXBRHZFJRMOC-BCZIGNCTSA-N
SMILES:C[C@]12[C@@]([C@]3(C)[C@@](CC1)(C(C)(C)[C@@H](O)CC3)[H])([C@H](OC)C=C4[C@@]2(C)CC[C@]5(C)[C@]4(CC(C)(C)CC5)[H])[H]
Synonyms:- Olean-12-en-3-ol, 11-methoxy-, (3β,11α)-
- (3β,11α)-11-Methoxyolean-12-en-3-ol
- Triptohypol F
- 3β-Hydroxy-11α-methoxy-olean-12-ene
Sort by
Found 3 products.
Triptohypol F
CAS:Controlled ProductTriptohypol F is a natural compound, classified as a triterpenoid, which is derived from the root extracts of the medicinal plant *Tripterygium wilfordii*. This compound is known for its unique mode of action involving the modulation of various cellular pathways, particularly those associated with inflammation and immune response. Triptohypol F is thought to exert its effects through the inhibition of specific enzymes and signaling molecules, which play a crucial role in inflammatory processes. The primary applications of Triptohypol F are in the realm of therapeutic interventions, particularly those targeting autoimmune and inflammatory diseases. The compound has been studied extensively for its potential role in suppressing aberrant immune responses without the severe side effects associated with traditional immunosuppressive agents. Ongoing research is exploring its effectiveness and safety profile in treating conditions such as rheumatoid arthritis, psoriasis, and other chronic inflammatory disorders. Its naturally derived origin provides a valuable alternative to synthetic drugs, with the potential for fewer side effects and a broader margin of safety.Formula:C31H52O2Purity:Min. 95%Molecular weight:456.7 g/molTriptohypol F
CAS:Triptohypol F is a natural product for research related to life sciences. The catalog number is TN5184 and the CAS number is 268541-26-0.Formula:C31H52O2Purity:98%Color and Shape:SolidMolecular weight:456.74