
CAS 27006-82-2: 5-chloro-1,3-dimethyl-1H-pyrazole-4-carboxylic acid
Formula:C6H7ClN2O2
InChI:InChI=1/C6H7ClN2O2/c1-3-4(6(10)11)5(7)9(2)8-3/h1-2H3,(H,10,11)
SMILES:Cc1c(c(Cl)n(C)n1)C(=O)O
Sort by
Found 4 products.
5-Chloro-1,3-dimethyl-1H-pyrazole-4-carboxylic acid
CAS:5-Chloro-1,3-dimethyl-1H-pyrazole-4-carboxylic acidMolecular weight:174.58g/mol5-CHLORO-1,3-DIMETHYL-1H-PYRAZOLE-4-CARBOXYLIC ACID
CAS:Formula:C6H7ClN2O2Purity:95%Color and Shape:SolidMolecular weight:174.5855-Chloro-1,3-dimethyl-1H-pyrazole-4-carboxylic acid
CAS:5-Chloro-1,3-dimethyl-1H-pyrazole-4-carboxylic acid (DMPC) is a reactive compound that has been shown to be optically active. DMPC is found in plants and is used as an antiseptic and germicide. It is also used as an ingredient in horticultural products. The chloro group on the DMPC molecule can react with other compounds, such as chloride ions, to form a chlorinated derivative which exhibits increased antibacterial activity. This increased antibacterial activity may be due to the fact that the chlorine atom in DMPC reacts with bacterial cell membranes, making them more permeable and leading to cell death.Formula:C6H7ClN2O2Purity:Min. 95%Molecular weight:174.59 g/mol5-Chloro-1,3-dimethyl-1H-pyrazole-4-carboxylic acid
CAS:Purity:97.0%Color and Shape:SolidMolecular weight:174.5800018310547